OPN expression inhibitor 1
OPN Expression Inhibitor 1 (Compound 11) is a DHA ether derivative containing a 1,2,3-triazole ring that effectively inhibits osteopontin (OPN) expression. It exhibits significant potential as an anticancer agent by specifically targeting OPN, a key factor in breast cancer progression and metastasis.
Catalog Number | E4781 |
Molecular Formula | C10H8N2O3 |
CAS# | 2257492-95-6 |
Inchi | InChI=1S/C10H8N2O3/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,13-14H,(H2,12,15)/b7-3+ |
Inchi Key | USOXQZNJFMKTKJ-XVNBXDOJSA-N |
SMILES | C1=CC(=C(C=C1C=C(C#N)C(=O)N)O)O |
Size | 100mg |
Supplier Page | http://www.selleckchem.com/products/opn-expression-inhibitor-1.html |
Additional Information | https://file.selleck.cn/downloads/struct/E4781-OPN-expression-inhibitor-1-chemical-structure.png |