Diflunisal
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30567 |
| Alternative Name(s) | NULL |
| Research Area | Diflunisal is a Nonsteroidal Anti-inflammatory Drug. The mechanism of action of diflunisal is as a Cyclooxygenase Inhibitor. The chemical classification of diflunisal is Nonsteroidal Anti-inflammatory Compounds. |
| Molecular Formula | C13H8F2O3 |
| CAS# | 22494-42-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=C(C2=CC(C(O)=O)=C(O)C=C2)C=CC(F)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30567.html |
| Additional Information | NULL |