C-171
C-171 is a covalent small-molecule inhibitor of STING. C-171 efficiently inhibits both hsSTING and mmSTING through covalently target the predicted transmembrane cysteine residue 91 and thereby block the activation-induced palmitoylation of STING.
| Trivial name | N/A |
| Catalog Number | E0128 |
| Molecular Formula | C17H20N2O4 |
| CAS# | 2244881-69-2 |
| SMILES | CCCCCCC1=CC=C(NC(=O)C2=CC=C(O2)[N+]([O-])=O)C=C1 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/c-171.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0128-c-171-chemical-structure.gif |