FB23
FB23 is a potent and selective inhibitor of FTO demethylase with IC50 of 60 nM. FB23 directly binds to FTO and selectively inhibits FTO’s mRNA N6-methyladenosine (m6A) demethylase activity.
| Trivial name | N/A |
| Catalog Number | S6291 |
| Molecular Formula | C18H14Cl2N2O3 |
| CAS# | 2243736-35-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=C(NC3=CC=CC=C3C(O)=O)C(=C2)Cl)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/fb23.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6291-fb23-chemical-structure.gif |