DCZ0415
DCZ0415 is a potent inhibitor of TRIP13. DCZ0415 impairs nonhomologous end joining repair and inhibits NF-κB activity. It triggers anti-myeloma effects both in vitro, and in vivo, and primary cells obtained from myeloma patients resistant to drugs.
| Catalog Number | E4686 |
| Molecular Formula | C20H19N7O |
| CAS# | 2242470-43-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N=NC4=C(N=C(C=C4)N)N)N=C2C=C1)N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dcz0415.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4686-DCZ0415-chemical-structure.png |
