MEDS433 | MedChemExpress (MCE)
MEDS433 is a potent inhibitor of human dihydroorotate dehydrogenase (hDHODH) with an IC50 of 1.2 nM. MEDS433 exerts a potent antiviral activity against RSV-A and RSV-B in the one-digit nanomolar range. MEDS433 induces the expression of antiviral proteins encoded by interferon stimulated genes (ISGs) able to reduce RSV replication[1].
| Trivial name | MEDS433 |
| Catalog Number | HY-156442 |
| Research Area | Infection |
| CAS# | 2241027-61-0 |
| Purity | ≥98.00% |
| SMILES | O=C(C1=C2C=CC=CN2N=C1O)NC3=C(F)C(F)=C(C4=CC=CC=C4)C(F)=C3F |
| PubChem Chemical Structure ID | 134686803 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/meds433.html |