JT002 | MedChemExpress (MCE)
JT002 is an orally active inhibitor of the NLRP3 inflammasome. JT002 reduces NLRP3-dependent proinflammatory cytokine (such as IL-1β, IL-1α, IL-18) production and pyroptosis. JT002 blocks NLRP3 inflammasome complex formation. JT002 reduces airway hyperresponsiveness and airway neutrophilia in mice[1].
| Trivial name | JT002 |
| Catalog Number | HY-149478 |
| Research Area | Inflammation/Immunology |
| CAS# | 2238820-43-2 |
| Purity | ≥98.00% |
| SMILES | O=C(NS(=O)(C1=C(OC[C@@H](OC)C2)N2N=C1)=O)NC3=C(CCC4)C4=CC5=C3CCC5 |
| PubChem Chemical Structure ID | 146225627 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jt002.html |