Tofisopam
API Standard
| Catalog Number | CS-O-30804 |
| Research Area | Tofisopam is a 2,3-benzodiazepine drug which is a benzodiazepine derivative. In contrast to classical 1,4-benzodiazepines, the compound does not bind to the benzodiazepine binding site of the gamma-aminobutyric acid receptor and its psychopharmacological |
| Molecular Formula | C22H26N2O4 |
| CAS# | 22345-47-7 |
| Purity | >98% |
| SMILES | CCC1C2=CC(OC)=C(OC)C=C2C(C3=CC(OC)=C(O[13C]([2H])([2H])[2H])C=C3)=NN=C1C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30804.html |