FG-2216
FG-2216 is a potent HIF-prolyl hydroxylase inhibitor with IC50 of 3.9 μM for PHD2 enzyme, orally bioavailable and induced significant and reversible Epo induction in vivo.
| Trivial name | YM 311 |
| Catalog Number | CSN16866 |
| Alternative Name(s) | YM 311 |
| Research Area | / |
| Molecular Formula | C12H9ClN2O4 |
| CAS# | 223387-75-5 |
| Purity | ≥99% |
| SMILES | O=C(O)CNC(C1=C(O)C2=C(C(Cl)=N1)C=CC=C2)=O |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/fg-2216.html |