XPC-5462 | MedChemExpress (MCE)
XPC-5462 is a NaV1.6 and NaV1.2 inhibitor with the IC50s of 10.9 nM and 10.3 nM, respectively. XPC-5462 suppresses epileptiform activity in an ex vivo brain slice seizure model[1].
| Trivial name | XPC-5462 |
| Catalog Number | HY-157786 |
| Research Area | Neurological Disease |
| CAS# | 2230145-14-7 |
| Purity | ≥98.0% |
| SMILES | O=S(NC1=CSC=N1)(C2=C(C=C(C=C2F)NCC3=C(C(F)=CC=C3F)CN4CCC4)F)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/xpc-5462.html |