WM-3835
WM-3835 is a novel and high-specific small molecule Lysine Acetyltransferase 7 (KAT7, MYST2, HBO1) inhibitor, able to potently suppressed OS cell proliferation and migration, and leads to apoptosis activation.
| Trivial name | N/A |
| Catalog Number | S9805 |
| Molecular Formula | C20H17FN2O4S |
| CAS# | 2229025-70-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NN[S](=O)(=O)C2=CC(=CC=C2)O)C3=CC=CC=C3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/wm-3835.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9805-wm-3835-chemical-structure.gif |