SZL P1-41
SZL P1-41 (compound #25) is a specific inhibitor of S-phase kinase-associated protein 2 (Skp2) that indeed binds to Skp2, prevents Skp2-Skp1 interaction and inhibits Skp2 SCF E3 ligase activity, which consequently suppresses survival of cancer cells and cancer stem cells. SZL P1-41 causes higher apoptosis rates in cancer cells.
| Trivial name | N/A |
| Catalog Number | S9724 |
| Molecular Formula | C24H24N2O3S |
| CAS# | 222716-34-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCC1=C(O)C(=C2OC=C(C(=O)C2=C1)C3=NC4=C(S3)C=CC=C4)CN5CCCCC5 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/szl-p1-41.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9724-szl-p1-41-chemical-structure.gif |