trans-Trimethoxyresveratrol
trans-Trimethoxyresveratrol is a derivative of resveratrol (RSV),and it may be a more potent anti-inflammatory, antiangiogenic and vascular-disrupting agent when compared with resveratrol.
| Trivial name | trans-Trismethoxy Resveratrol; E-Resveratrol Trimethyl Ether; Tri-O-methylresveratrol |
| Catalog Number | CSN19327 |
| Alternative Name(s) | trans-Trismethoxy Resveratrol; E-Resveratrol Trimethyl Ether; Tri-O-methylresveratrol |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C17H18O3 |
| CAS# | 22255-22-7 |
| Purity | ≥99% |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC(OC)=CC(OC)=C2 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/trans-trimethoxyresveratrol.html |
