7-Aminodeacetoxycephalosporanic acid (Standard) | MedChemExpress (MCE)
7-Aminodeacetoxycephalosporanic acid (Standard) is the analytical standard of 7-Aminodeacetoxycephalosporanic acid. This product is intended for research and analytical applications. 7-Aminodeacetoxycephalosporanic acid (7-ADCA) is a key intermediate in the synthesis of cephalosporins[1].
| Trivial name | 7-Aminodeacetoxycephalosporanic acid (Standard) |
| Catalog Number | HY-W014217R |
| Alternative Name(s) | 7-ADCA (Standard) |
| Research Area | Others |
| CAS# | 22252-43-3 |
| Purity | ≥98.0% |
| SMILES | O=C1N2[C@]([C@@H]1N)([H])SCC(C)=C2C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/7-aminodeacetoxycephalosporanic-acid-standard.html |