PTP1B-IN-24 | MedChemExpress (MCE)
PTP1B-IN-24 (Compound 9) is a reversible PTP1B inhibitor with an IC50 value of 1.4 μM, and PTP1B-IN-24 can enhance the thermal stability of PTP1B. PTP1B-IN-24 can restore PA- (HY-N0830) induced insulin resistance by increasing the phosphorylation levels of IRS1 and AKT[1].
| Trivial name | PTP1B-IN-24 |
| Catalog Number | HY-161321 |
| Research Area | Metabolic Disease |
| CAS# | 2221707-61-3 |
| Purity | ≥98.0% |
| SMILES | O=C(S/1)N(CC(NC2=CC=C(C)C=C2)=O)C(C1=C\C3=COC4=CC=CC=C4C3=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ptp1b-in-24.html |