Pyrantel Pamoate
Pyrantel Pamoate is a deworming agent in the treatment of parasitic worm infections including hookworms (all species) and roundworms in domesticated animal and acts as a depolarizing neuromuscular blocking agent.
| Trivial name | Pyrantel Embonate; Antiminth; Cobantril |
| Catalog Number | CSN11803 |
| Alternative Name(s) | Pyrantel Embonate; Antiminth; Cobantril |
| Research Area | Infection |
| Molecular Formula | C34H30N2O6S |
| CAS# | 22204-24-6 |
| Purity | ≥99% |
| SMILES | CN1CCCN=C1/C=C/C2=CC=CS2.O=C(O)C3=C(O)C(CC4=C5C=CC=CC5=CC(C(O)=O)=C4O)=C6C=CC=CC6=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/pyrantel-pamoate.html |
