(-)-Menthol
(-)-Menthol is a natural product obtained from the oils of corn mint, peppermint, or other mints, as a weak kappa opioid receptor agonist. It has local anesthetic and counterirritant qualities, and used to relieve minor throat irritation.
| Trivial name | L-Menthol |
| Catalog Number | CSN11317 |
| Alternative Name(s) | L-Menthol |
| Research Area | / |
| Molecular Formula | C10H20O |
| CAS# | 2216-51-5 |
| Purity | ≥99% |
| SMILES | O[C@H]1[C@H](C(C)C)CC[C@@H](C)C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/(-)-menthol.html |
