Menthol Crystals
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-30974 |
| Alternative Name(s) | (1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexanol; [1R-(1α,2β,5α)]-5-Methyl-2- (1-methylethyl)cyclohexanol; (-)-(1R,3R,4S)-Menthol; (-)-Menthol; (-)-Menthyl Alcohol; (-)-trans-p-Methan-cis-3-ol; (1R)-(-)-Menthol; (1R,2S,5R)-2-Isopropyl-5- m; L-Menthol |
| Research Area | (1R,2S,5R)-(-)-Menthol (L-Menthol) is the natural form of Menthol. L-Menthol is used as: refreshing agent, food flavor, cool and antipruritic drug, carminative drug. Menthol crystals is used for personal care and cosmetics. |
| Molecular Formula | C10H20O |
| CAS# | 2216-51-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC([C@H](CC[C@@H](C)C1)[C@@H]1O)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30974.html |
| Additional Information | NULL |