L- Biopterin
Natural Products
| Trivial name | NULL |
| Catalog Number | CS-O-30872 |
| Alternative Name(s) | 2-amino-6-[(1S,2R)-1,2-dihydroxypropyl]-3,4- dihydropteridin-4-one;CS-T-06522 |
| Research Area | A pteridine widely distributed in nature; naturally occurring as the L-erythro-form. Considered as a growth factor for some insects. Fluoresces with a blue color in alkaline solution. |
| Molecular Formula | C9H11N5O3 |
| CAS# | 22150-76-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=NC([C@@H](O)[C@@H](O)C)=CNC2=NC(N)=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30872.html |
| Additional Information | NULL |