Podocarpusflavone A
Podocarpusflavone A is a DNA topoisomerase I inhibitor isolated and purified from the barks of Podocarpus macrophyllus, and is the strongest noncytotoxic non-nucleotide molecule exhibiting a specific inhibitory activity against the RNA polymerase domain of DV-NS5 and thus is promising for chemotherapy development against dengue fever.
| Trivial name | Podocarpusflavone-A |
| Catalog Number | CSN14282 |
| Alternative Name(s) | Podocarpusflavone-A |
| Research Area | Cancer |
| Molecular Formula | C31H20O10 |
| CAS# | 22136-74-9 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=C(OC)C=C2)OC3=C(C4=CC(C5=CC(C6=C(O)C=C(O)C=C6O5)=O)=CC=C4O)C(O)=CC(O)=C13 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/podocarpusflavone-a.html |