Alclofenac | MedChemExpress (MCE)
Alclofenac (Allopydin) is a non-steroidal anti-inflammatory agent (NSAID). Alclofenac is a prostaglandin H2 synthase inhibitor. Alclofenac can be used for rheumatoid arthritis, degenerative joint disease and ankylosing spondylitis research[1][1][2].
| Trivial name | Alclofenac |
| Catalog Number | HY-W009706 |
| Alternative Name(s) | Allopydin; W-7320 |
| Research Area | Inflammation/Immunology |
| CAS# | 22131-79-9 |
| Purity | ≥98.0% |
| SMILES | C=CCOC1=C(Cl)C=C(CC(O)=O)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/alclofenac.html |