1NM-PP1(PP1 Analog II)
1NM-PP1 is a cell-permeable PP1 analog that acts as a potent and selective inhibitor of mutant kinases over their wild-type progenitors with IC50 of 28 μM for vSrc and 4.2 nM for v-Src-as1 I338G.
| Trivial name | 1-NM-PP 1 |
| Catalog Number | CSN15942 |
| Alternative Name(s) | 1-NM-PP 1 |
| Research Area | Cancer |
| Molecular Formula | C20H21N5 |
| CAS# | 221244-14-0 |
| Purity | ≥99% |
| SMILES | NC1=C2C(N(C(C)(C)C)N=C2CC3=C4C=CC=CC4=CC=C3)=NC=N1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/1nm-pp1(pp1-analog-ii).html |