PP1 Analog II, 1NM-PP1 5mg
PP1 Analog II, 1NM-PP1 is a cell-permeable PP1 analog that acts as a potent and selective inhibitor of mutant kinases over their wild-type progenitors.
| Trivial name | PP1 Analog II, 1NM-PP1 5mg |
| Catalog Number | A13573-5 |
| Alternative Name(s) | 1-(tert-butyl)-3-(naphthalen-1-ylmethyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Formula | C20H21N5 |
| CAS# | 221244-14-0 |
| SMILES | CC(C)(C)N1C2=C(C(=N1)CC3=CC=CC4=CC=CC=C43)C(=NC=N2)N |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/pp1-analog-ii-1nm-pp1.html |
