Ketoprofen
Ketoprofen is a dual COX1/2 inhibitor with IC50 of 0.5 μM and 2.33 μM for human recombinant COX-1 and COX-2, respectively, and used as a nonsteroidal anti-inflammatory drug (NSAID) to treat arthritis-related inflammatory pains.
| Trivial name | RP-19583 |
| Catalog Number | CSN11252 |
| Alternative Name(s) | RP-19583 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C16H14O3 |
| CAS# | 22071-15-4 |
| Purity | ≥99% |
| SMILES | C2=C(C(C1=CC=CC=C1)=O)C=CC=C2C(C(O)=O)C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/ketoprofen.html |