Potassium Oxonate
Oxonic Acid Potassium Salt is an inhibitor of uricase thus inhibits uric acid metabolism. It is used to induce hyperuricemia in mice of rats.
| Trivial name | Allantoxanic acid potassium salt;Oteracil potassium;Potassium azaorotate;Potassium otastat |
| Catalog Number | CSN22255 |
| Alternative Name(s) | Allantoxanic acid potassium salt;Oteracil potassium;Potassium azaorotate;Potassium otastat |
| Research Area | / |
| Molecular Formula | C4H2KN3O4 |
| CAS# | 2207-75-2 |
| Purity | ≥98% |
| SMILES | O=C(C(NC1=O)=NC(N1)=O)[O-].[K+] |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/potassium-oxonate.html |