Simazine D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02966 |
| Alternative Name(s) | 6-chloro-N2,N4-bis[(1,1,2,2,2-D5)ethyl]-1,3,5- triazine-2,4-diamine |
| Research Area | Labeled Simazine, intended for use as an internal standard for the quantification of Simazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H2D1ClN5 |
| CAS# | 220621-39-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=NC(NC([2H])([2H])C([2H])([2H])[2H])=NC(NC([2H])([2H])C([2H])([2H])[2H])=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02966.html |
| Additional Information | NULL |