Tigecycline
Tigecycline is a broad-spectrum glycylcycline antibiotic derived from tetracycline. Tigecycline binds to the 30S ribosomal subunit, thereby interfering with the binding of aminoacyl-tRNA to the mRNA-ribosome complex.
| Catalog Number | T1569 |
| Alternative Name(s) | GAR-936 |
| Research Area | Microbiology/Virology|||Autophagy |
| Molecular Formula | C29H39N5O8 |
| CAS# | 220620-09-7 |
| Purity | 99.94% |
| SMILES | C1(=O)C(=C([C@H]([C@@H]2C[C@@H]3Cc4c(cc(c(c4C(=O)C3=C([C@]12O)O)O)NC(=O)CNC(C)(C)C)N(C)C)N(C)C)O)C(=O)N |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Tigecycline |
| Additional Information | https://www.targetmol.com/datasheet/T1569 |
