Ticagrelor Metabolite-M8
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-05933 |
| Alternative Name(s) | deshydroxyethoxy ticagrelor;AR-C 124910XX;1S,2R,3S,4R)-4-[7-{[(1R,2S)-2-(3,4-Difluorophennyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl]-1,2l;;(1S,2R,3S,4R)-4-[7-{[(1R,2S)-2-(3,4-Difluorophennyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl]-1,2l; Deshydroxyethoxy Tcagrelor; ARc 124910XX;;CS-AI-00179; CS-O-06355; Ticagrelor Impurity G |
| Research Area | Deshydroxyethoxy Ticagrelor analog of Ticagrelor an antiplatelet agent, and preventative in the treatment of heart attacks, myocardial infarction, and other pulmonary diseases. |
| Molecular Formula | C21H24F2N6O3S |
| CAS# | 220347-05-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=C(F)C=CC([C@H]2[C@@H](C2)NC3=NC(SCCC)=NC4=C3N=NN4[C@H](C[C@H](O)[C@H]5O)[C@@H]5O)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05933.html |
| Additional Information | NULL |