Imatinib Mesylate
Imatinib Mesylate is a multi-target inhibitor of v-Abl, c-Kit and PDGFR with IC50 of 0.6 μM, 0.1 μM and 0.1 μM, respectively.
| Trivial name | CGP 57148B; ST 1571 Mesylate |
| Catalog Number | CSN16807 |
| Alternative Name(s) | CGP 57148B; ST 1571 Mesylate |
| Research Area | Cancer |
| Molecular Formula | C30H35N7O4S |
| CAS# | 220127-57-1 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=C(C)C(NC2=NC=CC(C3=CC=CN=C3)=N2)=C1)C4=CC=C(CN5CCN(C)CC5)C=C4.CS(=O)(O)=O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/imatinib-mesylate.html |