Imatinib Mesylate 10mM * 1mL in DMSO
Imatinib mesylate, a selective tyrosine kinase inhibitor, induced a sustained objective response in treating gastrointestinal stromal tumors with the inhibition of the KIT signal-transduction pathway.
| Trivial name | Imatinib Mesylate 10mM * 1mL in DMSO |
| Catalog Number | A10468-10mM-D |
| Alternative Name(s) | 4-(4-Methylpiperazin-1-ylmethyl)-N-[4-methyl-3-[4-(3-pyridyl)pyrimidin-2-ylamino]phenyl]benzamide methanesulfonate |
| Molecular Formula | C29H31N7O.CH4SO3 |
| CAS# | 220127-57-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5.CS(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/imatinib-mesylate.html |