Selamectin
Selamectin is an avermectin derivative prepared by hydrolysis and oximation of doramectin. Selamectin is a potent nematocide used for the treatment of parasites, which selectively binds to parasite glutamate-gated chloride ion channels and disrupts neurotransmission.
| Trivial name | UK-124114 |
| Catalog Number | CSN15941 |
| Alternative Name(s) | UK-124114 |
| Research Area | / |
| Molecular Formula | C43H63NO11 |
| CAS# | 220119-17-5 |
| Purity | ≥99% |
| SMILES | O=C(O[C@]1([H])C[C@@]2(O[C@H](C3CCCCC3)[C@@H](C)CC2)O[C@@]4([H])C1)[C@@]([C@]5([C@@](/C6=N/O)(OC/C5=C\C=C\[C@H](C)[C@@H](/C(C)=C/C4)O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](OC)C7)[H])O)(C=C6C)[H] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/selamectin.html |
