Binucleine 2
Binucleine 2 is an isoform-specific and ATP-competitive inhibitor of Drosophila Aurora B kinase (Ki = 0.36 μM), a kinase involved in cell division. It is specific for Drosophila Aurora B kinase, inhibiting it in a dose-dependent manner, with minimal inhibition of human or X. laevis Aurora B kinases at concentrations up to 100 μM. Binucleine 2 induces mitotic and cytokinesis defects in Drosophila Kc167 cells. It prevents Drosophila S2 cells from assembling a contractile ring during cell division when used at a concentration of 40 μM but does not affect ring ingression, suggesting that Aurora B kinase activity is not required for that step.
Catalog Number | T36801 |
Molecular Formula | C13H11ClFN5 |
CAS# | 220088-42-6 |
SMILES | CN(C)C=Nc1c(cnn1-c1ccc(F)c(Cl)c1)C#N |w:4.4| |
Size | 50 mg |
Supplier Page | https://www.targetmol.com/compound/binucleine_2 |
Additional Information | https://www.targetmol.com/datasheet/T36801 |