Ixabepilone
Ixabepilone is a microtubule inhibitor working by binding to tubulin and promoting tubulin polymerization and microtubule stabilization.
| Trivial name | Azaepothilone B; BMS 247550; BMS2475501 |
| Catalog Number | CSN18117 |
| Alternative Name(s) | Azaepothilone B; BMS 247550; BMS2475501 |
| Research Area | Cancer |
| Molecular Formula | C27H42N2O5S |
| CAS# | 219989-84-1 |
| Purity | ≥98% |
| SMILES | O=C(C[C@H](O)C1(C)C)N[C@H](/C(C)=C/C2=CSC(C)=N2)C[C@]3([H])O[C@]3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C1=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/ixabepilone.html |