Ixabepilone
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-11998 |
| Alternative Name(s) | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-((E)-1-(2-methylthiazol-4-yl)prop-1-en-2-yl)-17-oxa-4-aztadecane-5,9-dione |
| Research Area | Ixabepilone is an anti-tumor agent used in the treatment of patients suffering from solid tumors, such as metastatic breast cancer. |
| Molecular Formula | C27H42N2O5S |
| CAS# | 219989-84-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(CCC[C@@H]([C@@H]([C@H](C2=O)C)O)C)[C@H](C[C@H](NC(C[C@@H](C2(C)C)O)=O)/C(C)=C/C3=CSC(C)=N3)O1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11998.html |
| Additional Information | NULL |