7,4′-Dihydroxyflavone
7,4′-Dihydroxyflavone (7,4′-DHF) is a flavonoid, which can be isolated from Glycyrrhiza uralensis. 7,4′-Dihydroxyflavone is eotaxin/CCL11 inhibitor and CBR1 inhibitor (IC50=0.28 μM). 7,4′-Dihydroxyflavone has the ability to consistently suppress eotaxin production and prevent dexamethasone (Dex)‐paradoxical adverse effects on eotaxin production. 7,4′-Dihydroxyflavone (7,4′-DHF) inhibits MUC5AC gene expression, mucus production and secretion via regulation of NF-κB, STAT6 and HDAC2.7,4′-Dihydroxyflavone (7,4′-DHF) decreases phorbol 12-myristate 13-acetate (PMA) stimulated NCI-H292 human airway epithelial cell MUC5AC gene expression and mucus production with IC50 value of 1.4 µM.
| Catalog Number | E7240 |
| Molecular Formula | C21H26N2O7 |
| CAS# | 2196-14-7 |
| Inchi | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
| Inchi Key | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/7-4-dihydroxyflavone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7240-7-4-dihydroxyflavone-chemical-structure-tube.png |
