Z-VDVAD-AFC | MedChemExpress (MCE)
Z-VDVAD-AFC is a fluorogenic substrate. Z-VDVAD-AFC is used to measure the activity of cysteine protease 3 (Caspase-3). Z-VDVAD-AFC undergoes hydrolysis to release 7-amino-4-trifluoromethylcoumarin (AFC). AFC is fluorescent under ultraviolet light and can emit fluorescent signals[1].
| Trivial name | Z-VDVAD-AFC |
| Catalog Number | HY-P4400 |
| Research Area | Others |
| CAS# | 219138-08-6 |
| Purity | ≥98.00% |
| SMILES | FC(F)(C(C1=CC=C(NC([C@H](CC(O)=O)NC([C@H](C)NC([C@H](C(C)C)NC([C@H](CC(O)=O)NC([C@H](C(C)C)NC(OCC2=CC=CC=C2)=O)=O)=O)=O)=O)=O)C=C1O3)=CC3=O)F |
| PubChem Chemical Structure ID | 99647821 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-vdvad-afc.html |