Bardoxolone methyl (RTA 402) 10mM * 1mL in DMSO
Bardoxolone methyl is an orally-available first-in-class synthetic triterpenoid. It is an inducer of the Nrf2 pathway, which can suppress oxidative stress and inflammation.
Trivial name | Bardoxolone methyl (RTA 402) 10mM * 1mL in DMSO |
Catalog Number | A11323-10mM-D |
Alternative Name(s) | Methyl 2-cyano-3,12-dioxooleana-1,9(11)dien-28-oate |
Molecular Formula | C32H43NO4 |
CAS# | 218600-53-4 |
SMILES | C[C@@]12CC[C@]3(CCC(C[C@H]3[C@H]1C(=O)C=C4[C@]2(CC[C@@H]5[C@@]4(C=C(C(=O)C5(C)C)C#N)C)C)(C)C)C(=O)OC |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/bardoxolone-methyl-rta-402.html |