14,15-EET-SI | MedChemExpress (MCE)
14,15-EET-SI is a sulfonimide (SI) analog metabolized from 14,15-EET, which is also an effective mitogen. 14,15-EET-SI can stimulate the incorporation of [3H] thymidine, activate pp60c-src and initiate the tyrosine kinase cascade, mediating their mitotic effects. Additionally, 14,15-EET-SI can increase cell proliferation as well as the expression of c-fos and egr-1 mRNA[1].
| Trivial name | 14,15-EET-SI |
| Catalog Number | HY-131721 |
| Research Area | Others |
| CAS# | 218461-97-3 |
| Purity | ≥98.0% |
| SMILES | CS(NC(CCC/C=C\C/C=C\C/C=C\CC1C(O1)CCCCC)=O)(=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/14-15-eet-si.html |