BDP R6G amine hydrochloride | MedChemExpress (MCE)
BDP R6G amine hydrochloride is a boronic dipyrromethene dye matched to the rhodamine 6G (R6G) channel. The fluorophore derivative contains an aliphatic amine group in the form of a salt. Amine groups can be conjugated to electrophiles. Amines can also be used for enzymatic transamination.
| Trivial name | BDP R6G amine hydrochloride |
| Catalog Number | HY-D1369 |
| CAS# | 2183473-06-3 |
| Purity | ≥98.0% |
| SMILES | O=C(CCC1=CC=C2C=C3C=CC(C4=CC=CC=C4)=[N]3[B+3]([F-])([N-]21)[F-])NCCCCCCN.[H]Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bdp-r6g-amine-hydrochloride.html |