FAM hydrazide, 6-isomer hydrochloride | MedChemExpress (MCE)
FAM hydrazide, 6-isomer hydrochloride is a hydrazide derivative of fluorescein (FAM). FAM is a xanthene dye, a parent of fluorescein dye series. FAM hydrazide, 6-isomer hydrochloride can be used for the labeling of carbonyl compounds, aldehydes, and ketones[1].
| Trivial name | FAM hydrazide, 6-isomer hydrochloride |
| Catalog Number | HY-132264 |
| Research Area | Others |
| CAS# | 2183440-65-3 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC(C2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)O5)=C(C=C1)C5=O)NN.[H]Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fam-hydrazide-6-isomer-hydrochloride.html |