Sulfo-cyanine7 alkyne potassium | MedChemExpress (MCE)
Sulfo-cyanine7 alkyne potassium is a water-soluble near-infrared dye with a sulfonated terminal alkyne that can be used in copper-catalyzed click chemistry reactions to conjugate with azides in an aqueous environment.
Trivial name | Sulfo-cyanine7 alkyne potassium |
Catalog Number | HY-D1307A |
CAS# | 2183440-56-2 |
Purity | ≥98.0% |
SMILES | O=C(CCCCC[N+]1=C(/C=C/C2=C/C(CCC2)=C/C=C3N(C)C4=CC=C(S(=O)(O[K])=O)C=C4C/3(C)C)C(C)(C)C5=C1C=CC(S(=O)([O-])=O)=C5)NCC#C |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/sulfo-cyanine7-alkyne-potassium.html |