SRPIN340 25mg
SRPIN340 is a cell-permeable isonicotinamide that acts as an ATP-competitive SRPK1-selective inhibitor (IC50 = 0.14 and 1.8 ??M, respectively, against mSRPK1 and mSRPK2) with much reduced activity against 143 other kinases.
| Trivial name | SRPIN340 25mg |
| Catalog Number | A13188-25 |
| Alternative Name(s) | N-(2-Piperidin-1-yl-5-(trifluoromethyl)phenyl)isonicotinamide |
| Molecular Formula | C18H18F3N3O |
| CAS# | 218156-96-8 |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)NC(=O)C3=CC=NC=C3 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/srpin340.html |
