Daunorubicinone
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-07761 |
| Alternative Name(s) | (8S,10S)-11-tetrahydroxy-1-methoxy- -5,12-naphaunomcinone; Daunomcin Aglcone; Daunomcinon; Daunorubcin Aglcone; Leukaemomcinonec; |
| Research Area | The main metabolite of Daunorubicin |
| Molecular Formula | C21H18O8 |
| CAS# | 21794-55-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C1=CC=C2)=C2OC)C(C(C1=O)=C3O)=C(C4=C3C[C@](C(C)=O)(O)C[C@@H]4O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07761.html |
| Additional Information | NULL |