BCX 1470 methanesulfonate 10mg
BCX 1470 is serine protease inhibitor. BCX 1470 blocks the esterolytic and hemolytic activities of the complement enzymes Cls and factor D in vitro.
| Trivial name | BCX 1470 methanesulfonate 10mg |
| Catalog Number | A11325-10 |
| Alternative Name(s) | 2-(aminoiminomethyl)benzo[b]thiophen-6-yl ester methanesulfonate (1:1) |
| Molecular Formula | C15H14N2O5S3 |
| CAS# | 217099-44-0 |
| SMILES | CS(=O)(=O)O.C1=CSC(=C1)C(=O)OC2=CC3=C(C=C2)C=C(S3)C(=N)N |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bcx-1470-methanesulfonate.html |
