UT-34
UT-34 is a potent, selective and orally bioavailable second-generation androgen receptor (AR) pan antagonist and degrader with IC50 of 203.46 nM, 80.78 nM and 94.17 nM for wild-type, T877A and W741L AR, respectively. UT-34 is a potential next-generation therapeutic for enzalutamide-resistant prostate cancer.
| Trivial name | N/A |
| Catalog Number | S8885 |
| Molecular Formula | C15H12F4N4O2 |
| CAS# | 2168525-92-4 |
| SMILES | CC(CN1C=C(C=N1)F)(C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ut-34.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s8885-ut-34-chemical-structure.gif |