Fludarabine
Fludarabine is a STAT1 activation inhibitor which causes a specific depletion of STAT1 protein (and mRNA) but not of other STATs. Also a DNA synthesis inhibitor in vascular smooth muscle cells. Fludarabine induces apoptosis.
| Trivial name | FaraA, Fludarabinum, NSC 118218 |
| Catalog Number | S1491 |
| Molecular Formula | C11H14N4O4 |
| CAS# | 21679-14-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | NC1=C2N=C[N](C3OC(CO)C(O)C3O)C2=CC=N1 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Fludarabine(Fludara).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Fludarabine-chemical-structure-s1491.gif |