5-ROX
5-ROX is a pure-5 isomer derived from carboxy-X-rhodamine, a fluorescent oligonucleotide marker, acts as a donor molecule in FRET imaging coupled with porphyrins.5-ROX is widely used for oligonucleotide labeling and automated DNA sequencing applications.
| Trivial name | 5-Carboxy-X-rhodamine |
| Catalog Number | CSN16995 |
| Alternative Name(s) | 5-Carboxy-X-rhodamine |
| Research Area | / |
| Molecular Formula | C33H30N2O5 |
| CAS# | 216699-35-3 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=C(C(C2=CC3=C4N(CCC3)CCCC4=C2[O+]=C56)=C5C=C7CCCN8CCCC6=C87)C(C([O-])=O)=C1)O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/5-rox.html |