Aluminium hydroxide
Aluminium hydroxide (Aluminic), found in nature as the mineral gibbsite, is amphoteric (i.e., it has both basic and acidic properties). It is used to treat symptoms of increased stomach acid, such as heartburn, upset stomach, sour stomach, or acid indigestion; also reduce phosphate levels in people with certain kidney conditions.
| Trivial name | Aluminic hydroxide, Aluminum trihydroxide, Aluminium(III) hydroxide |
| Catalog Number | S4826 |
| Molecular Formula | C27H26ClN3O7S2 |
| CAS# | 21645-51-2 |
| SMILES | CCOC(=O)CN(CC1=CC=CS1)C(=O)C(C2=CC=CC=C2OC)NS(=O)(=O)C3=C(C=C4C(=C3)C=CC(=O)N4)Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/aluminium-hydroxide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/aluminium-hydroxide-chemical-structure-s4826.gif |
