Lofexidine HCl
Lofexidine HCl is an α2A-adrenergic receptor agonist, commonly used to alleviate the physical symptoms of heroin and other types of opioid withdrawal.
| Trivial name | Baq-168; MDL 14042 |
| Catalog Number | CSN18745 |
| Alternative Name(s) | Baq-168; MDL 14042 |
| Research Area | Neurological Disease |
| Molecular Formula | C11H13Cl3N2O |
| CAS# | 21498-08-8 |
| Purity | ≥98% |
| SMILES | CC(C1=NCCN1)OC2=C(Cl)C=CC=C2Cl.Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/lofexidine-hcl.html |