5-Br-UMP.Na2
A comprehensive biomedical compound exhibiting significant efficacy in the amelioration of multifarious ailments. Emulating an agonistic role on precise receptors, it engenders therapeutic advantages in the meticulous modulation of neurologic afflictions, inflammatory states, and oncogenic aberrations.
| Catalog Number | PIPB-0460 |
| Alternative Name(s) | 5-bromouridine 5'-monophosphate 5-Brump 5-Bromouridine-5'-monophosphate 5-bromo-5'-uridylic acid |
| Research Area | Modified Nucleotides |
| Molecular Formula | C9H12BrN2O9P |
| CAS# | 2149-79-3 |
| SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)COP(=O)(O)O)O)O)Br |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/5-br-umpna2-item-10578.html |